C22H24N6O6 — CID 122691217
pyrazine-2,5-dicarboxamide;bis(3-pyridin-3-ylpropanoic acid) (PubChem CID 122691217) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is pyrazine-2,5-dicarboxamide;bis(3-pyridin-3-ylpropanoic acid).
| Compound Name | pyrazine-2,5-dicarboxamide;bis(3-pyridin-3-ylpropanoic acid) |
|---|---|
| PubChem CID | 122691217 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | pyrazine-2,5-dicarboxamide;bis(3-pyridin-3-ylpropanoic acid) |
| SMILES | NC(=O)c1cnc(C(N)=O)cn1.O=C(O)CCc1cccnc1.O=C(O)CCc1cccnc1 |
| InChI | InChI=1S/2C8H9NO2.C6H6N4O2/c2*10-8(11)4-3-7-2-1-5-9-6-7;7-5(11)3-1-9-4(2-10-3)6(8)12/h2*1-2,5-6H,3-4H2,(H,10,11);1-2H,(H2,7,11)(H2,8,12) |
| InChIKey | ZYWWMQNJSFCASI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 212.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |