C21H28N4OS — CID 5128597
2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-(3-methylbutyl)acetamide (PubChem CID 5128597) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 5128597 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[[benzyl(pyridin-3-ylmethyl)carbamothioyl]amino]-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CNC(=S)N(Cc1ccccc1)Cc1cccnc1 |
| InChI | InChI=1S/C21H28N4OS/c1-17(2)10-12-23-20(26)14-24-21(27)25(15-18-7-4-3-5-8-18)16-19-9-6-11-22-13-19/h3-9,11,13,17H,10,12,14-16H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | LTBCLPAPHWLRJV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|