C24H39N5OS — CID 3172573
3-[3-(diethylamino)propyl]-1-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3172573) has the molecular formula C24H39N5OS and a molecular weight of 445.68 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3172573 |
| Molecular Formula | C24H39N5OS |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[2-(dimethylamino)ethyl]-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)N(CCN(C)C)Cc1cc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C24H39N5OS/c1-7-28(8-2)11-9-10-25-24(31)29(13-12-27(5)6)17-21-16-20-14-18(3)19(4)15-22(20)26-23(21)30/h14-16H,7-13,17H2,1-6H3,(H,25,31)(H,26,30) |
| InChIKey | CXULMYYJSJUGHQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|