C27H36N4O4S — CID 3177246
1-[2-(diethylamino)ethyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 3177246) has the molecular formula C27H36N4O4S and a molecular weight of 512.68 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3177246 |
| Molecular Formula | C27H36N4O4S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCN(CC)CC)Cc2cc3cc(OC)c(OC)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C27H36N4O4S/c1-6-30(7-2)13-14-31(27(36)28-21-9-11-22(12-10-21)35-8-3)18-20-15-19-16-24(33-4)25(34-5)17-23(19)29-26(20)32/h9-12,15-17H,6-8,13-14,18H2,1-5H3,(H,28,36)(H,29,32) |
| InChIKey | BBBACIFZMYJEEH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|