C26H31N3O3 — CID 4193062
1-benzyl-3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 4193062) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-benzyl-3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 1-benzyl-3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 4193062 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 1-benzyl-3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccccc3)C(=O)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-32-23-13-14-24-20(16-23)15-21(25(30)28-24)18-29(17-19-9-5-3-6-10-19)26(31)27-22-11-7-4-8-12-22/h3,5-6,9-10,13-16,22H,2,4,7-8,11-12,17-18H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | BOXGYDPGDLHMNZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |