C26H30ClN3O2 — CID 3194704
1-[(2-chlorophenyl)methyl]-3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 3194704) has the molecular formula C26H30ClN3O2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 3194704 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccccc3Cl)C(=O)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H30ClN3O2/c1-2-18-12-13-24-20(14-18)15-21(25(31)29-24)17-30(16-19-8-6-7-11-23(19)27)26(32)28-22-9-4-3-5-10-22/h6-8,11-15,22H,2-5,9-10,16-17H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | DWPZJNCZVLPXPF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |