C24H33N3O3 — CID 1138179
3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 1138179) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 1138179 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(C[C@@H]3CCCO3)C(=O)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C24H33N3O3/c1-2-17-10-11-22-18(13-17)14-19(23(28)26-22)15-27(16-21-9-6-12-30-21)24(29)25-20-7-4-3-5-8-20/h10-11,13-14,20-21H,2-9,12,15-16H2,1H3,(H,25,29)(H,26,28)/t21-/m0/s1 |
| InChIKey | IQKVWLRIJFLXGZ-NRFANRHFSA-N |
| XLogP | 4.11 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |