C26H23ClN2O2 — CID 3193943
N-[(4-chlorophenyl)methyl]-N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide (PubChem CID 3193943) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3193943 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccc(Cl)cc3)C(=O)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C26H23ClN2O2/c1-2-18-10-13-24-21(14-18)15-22(25(30)28-24)17-29(16-19-8-11-23(27)12-9-19)26(31)20-6-4-3-5-7-20/h3-15H,2,16-17H2,1H3,(H,28,30) |
| InChIKey | UOCOHEVPIWDDIQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |