C26H24ClN3O3 — CID 1430688
3-benzyl-1-[(4-chlorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 1430688) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 3-benzyl-1-[(4-chlorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 3-benzyl-1-[(4-chlorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 1430688 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3-benzyl-1-[(4-chlorophenyl)methyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(Cc3ccc(Cl)cc3)C(=O)NCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C26H24ClN3O3/c1-33-23-11-12-24-20(14-23)13-21(25(31)29-24)17-30(16-19-7-9-22(27)10-8-19)26(32)28-15-18-5-3-2-4-6-18/h2-14H,15-17H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | QEVJPYZLRORCAL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |