C22H32N4O3 — CID 1430556
3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 1430556) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 1430556 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(CCN(C)C)C(=O)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C22H32N4O3/c1-25(2)11-12-26(22(28)23-18-7-5-4-6-8-18)15-17-13-16-14-19(29-3)9-10-20(16)24-21(17)27/h9-10,13-14,18H,4-8,11-12,15H2,1-3H3,(H,23,28)(H,24,27) |
| InChIKey | AYPLUWNQKNJGDA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |