C26H38N4O3S — CID 3172068
1-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3172068) has the molecular formula C26H38N4O3S and a molecular weight of 486.68 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3172068 |
| Molecular Formula | C26H38N4O3S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 1-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(C(=S)NCCCN3CCOCC3)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H38N4O3S/c1-2-33-23-9-10-24-20(18-23)17-21(25(31)28-24)19-30(22-7-4-3-5-8-22)26(34)27-11-6-12-29-13-15-32-16-14-29/h9-10,17-18,22H,2-8,11-16,19H2,1H3,(H,27,34)(H,28,31) |
| InChIKey | OKPCMLIKVHBAFO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|