C25H27N3O5S — CID 3174199
methyl 2-[[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate (PubChem CID 3174199) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is methyl 2-[[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3174199 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | methyl 2-[[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(Cc1cc2cc(OC)ccc2[nH]c1=O)CC1CCCO1 |
| InChI | InChI=1S/C25H27N3O5S/c1-31-18-9-10-21-16(13-18)12-17(23(29)26-21)14-28(15-19-6-5-11-33-19)25(34)27-22-8-4-3-7-20(22)24(30)32-2/h3-4,7-10,12-13,19H,5-6,11,14-15H2,1-2H3,(H,26,29)(H,27,34) |
| InChIKey | HOQNDLOUJRRLPI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|