C26H29N3O5S — CID 3174200
methyl 2-[[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate (PubChem CID 3174200) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is methyl 2-[[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3174200 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | methyl 2-[[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(oxolan-2-ylmethyl)carbamothioyl]amino]benzoate |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CC3CCCO3)C(=S)Nc3ccccc3C(=O)OC)cc2c1 |
| InChI | InChI=1S/C26H29N3O5S/c1-3-33-19-10-11-22-17(14-19)13-18(24(30)27-22)15-29(16-20-7-6-12-34-20)26(35)28-23-9-5-4-8-21(23)25(31)32-2/h4-5,8-11,13-14,20H,3,6-7,12,15-16H2,1-2H3,(H,27,30)(H,28,35) |
| InChIKey | LWIMUQAOPYXMPP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|