C29H29N3O6S — CID 1149916
methyl 2-[[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl-[(4-methoxyphenyl)methyl]carbamothioyl]amino]benzoate (PubChem CID 1149916) has the molecular formula C29H29N3O6S and a molecular weight of 547.63 g/mol. Its IUPAC name is methyl 2-[[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl-[(4-methoxyphenyl)methyl]carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl-[(4-methoxyphenyl)methyl]carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 1149916 |
| Molecular Formula | C29H29N3O6S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | methyl 2-[[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl-[(4-methoxyphenyl)methyl]carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(Cc1ccc(OC)cc1)Cc1cc2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C29H29N3O6S/c1-35-21-11-9-18(10-12-21)16-32(29(39)31-23-8-6-5-7-22(23)28(34)38-4)17-20-13-19-14-25(36-2)26(37-3)15-24(19)30-27(20)33/h5-15H,16-17H2,1-4H3,(H,30,33)(H,31,39) |
| InChIKey | RBDGZFWGJFXPGR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|