C24H25N3O4S — CID 1375324
3-benzyl-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 1375324) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 3-benzyl-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-benzyl-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1375324 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-benzyl-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(C[C@H]1CCCO1)C(=S)NCc1ccccc1)OCO3 |
| InChI | InChI=1S/C24H25N3O4S/c28-23-18(9-17-10-21-22(31-15-30-21)11-20(17)26-23)13-27(14-19-7-4-8-29-19)24(32)25-12-16-5-2-1-3-6-16/h1-3,5-6,9-11,19H,4,7-8,12-15H2,(H,25,32)(H,26,28)/t19-/m1/s1 |
| InChIKey | CHYNSQDAGUSKDM-LJQANCHMSA-N |
| XLogP | 3.31 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|