C23H33N3O2S — CID 3177023
1-cyclopentyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 3177023) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-cyclopentyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 3177023 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 1-cyclopentyl-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)N(Cc1cc2c(C)ccc(C)c2[nH]c1=O)C1CCCC1 |
| InChI | InChI=1S/C23H33N3O2S/c1-4-28-13-7-12-24-23(29)26(19-8-5-6-9-19)15-18-14-20-16(2)10-11-17(3)21(20)25-22(18)27/h10-11,14,19H,4-9,12-13,15H2,1-3H3,(H,24,29)(H,25,27) |
| InChIKey | BJTIKOAPRRAOPU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|