C23H20FN3O4 — CID 1430788
3-(4-fluorophenyl)-1-(furan-2-ylmethyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 1430788) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(furan-2-ylmethyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 3-(4-fluorophenyl)-1-(furan-2-ylmethyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 1430788 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(furan-2-ylmethyl)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | COc1ccc2cc(CN(Cc3ccco3)C(=O)Nc3ccc(F)cc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H20FN3O4/c1-30-19-9-4-15-11-16(22(28)26-21(15)12-19)13-27(14-20-3-2-10-31-20)23(29)25-18-7-5-17(24)6-8-18/h2-12H,13-14H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | PAHMXVLDHDIPAO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |