C11H16F2N2O4S — CID 106242536
3-amino-2,4-difluoro-N-(3-hydroxy-4-methoxybutyl)benzenesulfonamide (PubChem CID 106242536) has the molecular formula C11H16F2N2O4S and a molecular weight of 310.32 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-(3-hydroxy-4-methoxybutyl)benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-(3-hydroxy-4-methoxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106242536 |
| Molecular Formula | C11H16F2N2O4S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-amino-2,4-difluoro-N-(3-hydroxy-4-methoxybutyl)benzenesulfonamide |
| SMILES | COCC(O)CCNS(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C11H16F2N2O4S/c1-19-6-7(16)4-5-15-20(17,18)9-3-2-8(12)11(14)10(9)13/h2-3,7,15-16H,4-6,14H2,1H3 |
| InChIKey | PJSLRRPXNZNHRZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|