C10H19ClN2O3S2 — CID 86780765
N-(2-aminopentyl)-3-methoxythiophene-2-sulfonamide;hydrochloride (PubChem CID 86780765) has the molecular formula C10H19ClN2O3S2 and a molecular weight of 314.86 g/mol. Its IUPAC name is N-(2-aminopentyl)-3-methoxythiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(2-aminopentyl)-3-methoxythiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 86780765 |
| Molecular Formula | C10H19ClN2O3S2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(2-aminopentyl)-3-methoxythiophene-2-sulfonamide;hydrochloride |
| SMILES | CCCC(N)CNS(=O)(=O)c1sccc1OC.Cl |
| InChI | InChI=1S/C10H18N2O3S2.ClH/c1-3-4-8(11)7-12-17(13,14)10-9(15-2)5-6-16-10;/h5-6,8,12H,3-4,7,11H2,1-2H3;1H |
| InChIKey | QQNUHRDIGMCSIL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |