C9H11NO4S2 — CID 126821576
N-(1-hydroxybut-3-yn-2-yl)-3-methoxythiophene-2-sulfonamide (PubChem CID 126821576) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(1-hydroxybut-3-yn-2-yl)-3-methoxythiophene-2-sulfonamide.
| Compound Name | N-(1-hydroxybut-3-yn-2-yl)-3-methoxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126821576 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | N-(1-hydroxybut-3-yn-2-yl)-3-methoxythiophene-2-sulfonamide |
| SMILES | C#CC(CO)NS(=O)(=O)c1sccc1OC |
| InChI | InChI=1S/C9H11NO4S2/c1-3-7(6-11)10-16(12,13)9-8(14-2)4-5-15-9/h1,4-5,7,10-11H,6H2,2H3 |
| InChIKey | JRWINQRIQJVLFV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|