C11H19ClN2O3S2 — CID 119970815
N-(4-aminocyclohexyl)-3-methoxythiophene-2-sulfonamide;hydrochloride (PubChem CID 119970815) has the molecular formula C11H19ClN2O3S2 and a molecular weight of 326.87 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-methoxythiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3-methoxythiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119970815 |
| Molecular Formula | C11H19ClN2O3S2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-methoxythiophene-2-sulfonamide;hydrochloride |
| SMILES | COc1ccsc1S(=O)(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C11H18N2O3S2.ClH/c1-16-10-6-7-17-11(10)18(14,15)13-9-4-2-8(12)3-5-9;/h6-9,13H,2-5,12H2,1H3;1H |
| InChIKey | FGDIPFDPKWRUPM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |