C13H22N2O3S2 — CID 126809966
N-[2-(dimethylamino)cyclohexyl]-3-methoxythiophene-2-sulfonamide (PubChem CID 126809966) has the molecular formula C13H22N2O3S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)cyclohexyl]-3-methoxythiophene-2-sulfonamide.
| Compound Name | N-[2-(dimethylamino)cyclohexyl]-3-methoxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126809966 |
| Molecular Formula | C13H22N2O3S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-[2-(dimethylamino)cyclohexyl]-3-methoxythiophene-2-sulfonamide |
| SMILES | COc1ccsc1S(=O)(=O)NC1CCCCC1N(C)C |
| InChI | InChI=1S/C13H22N2O3S2/c1-15(2)11-7-5-4-6-10(11)14-20(16,17)13-12(18-3)8-9-19-13/h8-11,14H,4-7H2,1-3H3 |
| InChIKey | PFQZGAPROWAYGT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |