C11H19ClN2O3S2 — CID 120723173
3-methoxy-N-(4-methylpiperidin-3-yl)thiophene-2-sulfonamide;hydrochloride (PubChem CID 120723173) has the molecular formula C11H19ClN2O3S2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 3-methoxy-N-(4-methylpiperidin-3-yl)thiophene-2-sulfonamide;hydrochloride.
| Compound Name | 3-methoxy-N-(4-methylpiperidin-3-yl)thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120723173 |
| Molecular Formula | C11H19ClN2O3S2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-methoxy-N-(4-methylpiperidin-3-yl)thiophene-2-sulfonamide;hydrochloride |
| SMILES | COc1ccsc1S(=O)(=O)NC1CNCCC1C.Cl |
| InChI | InChI=1S/C11H18N2O3S2.ClH/c1-8-3-5-12-7-9(8)13-18(14,15)11-10(16-2)4-6-17-11;/h4,6,8-9,12-13H,3,5,7H2,1-2H3;1H |
| InChIKey | NYNTXZRTEANKRK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |