C14H22BrClN2O3S — CID 120722535
5-bromo-2-methoxy-4-methyl-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride (PubChem CID 120722535) has the molecular formula C14H22BrClN2O3S and a molecular weight of 413.77 g/mol. Its IUPAC name is 5-bromo-2-methoxy-4-methyl-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 5-bromo-2-methoxy-4-methyl-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722535 |
| Molecular Formula | C14H22BrClN2O3S |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 5-bromo-2-methoxy-4-methyl-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride |
| SMILES | COc1cc(C)c(Br)cc1S(=O)(=O)NC1CNCCC1C.Cl |
| InChI | InChI=1S/C14H21BrN2O3S.ClH/c1-9-4-5-16-8-12(9)17-21(18,19)14-7-11(15)10(2)6-13(14)20-3;/h6-7,9,12,16-17H,4-5,8H2,1-3H3;1H |
| InChIKey | UFIYSCCFMKPSNT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |