C22H26F2N2O — CID 55835804
N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-4-propan-2-ylbenzamide (PubChem CID 55835804) has the molecular formula C22H26F2N2O and a molecular weight of 372.46 g/mol. Its IUPAC name is N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-4-propan-2-ylbenzamide.
| Compound Name | N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55835804 |
| Molecular Formula | C22H26F2N2O |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NC2CCN(Cc3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26F2N2O/c1-15(2)17-4-6-18(7-5-17)22(27)25-19-9-11-26(12-10-19)14-16-3-8-20(23)21(24)13-16/h3-8,13,15,19H,9-12,14H2,1-2H3,(H,25,27) |
| InChIKey | VMMCFSIESLPDBK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |