C24H27N5O2S — CID 55775744
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide (PubChem CID 55775744) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55775744 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide |
| SMILES | CSc1nccn1-c1ccc(C(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O2S/c1-32-24-25-13-16-29(24)21-9-7-18(8-10-21)23(31)27-20-11-14-28(15-12-20)17-22(30)26-19-5-3-2-4-6-19/h2-10,13,16,20H,11-12,14-15,17H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | QUZWHLSPIZBQGV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |