C21H20N4O2S — CID 25475114
N-cyclopropyl-3-[[2-(1-phenylimidazol-2-yl)sulfanylacetyl]amino]benzamide (PubChem CID 25475114) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-cyclopropyl-3-[[2-(1-phenylimidazol-2-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[2-(1-phenylimidazol-2-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 25475114 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-cyclopropyl-3-[[2-(1-phenylimidazol-2-yl)sulfanylacetyl]amino]benzamide |
| SMILES | O=C(CSc1nccn1-c1ccccc1)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H20N4O2S/c26-19(14-28-21-22-11-12-25(21)18-7-2-1-3-8-18)23-17-6-4-5-15(13-17)20(27)24-16-9-10-16/h1-8,11-13,16H,9-10,14H2,(H,23,26)(H,24,27) |
| InChIKey | CQYLVLTXATUNPQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |