C15H16ClFN4OS — CID 34796702
N-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-4-yl]-4-fluorobenzamide (PubChem CID 34796702) has the molecular formula C15H16ClFN4OS and a molecular weight of 354.84 g/mol. Its IUPAC name is N-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 34796702 |
| Molecular Formula | C15H16ClFN4OS |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[1-[(5-chlorothiadiazol-4-yl)methyl]piperidin-4-yl]-4-fluorobenzamide |
| SMILES | O=C(NC1CCN(Cc2nnsc2Cl)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16ClFN4OS/c16-14-13(19-20-23-14)9-21-7-5-12(6-8-21)18-15(22)10-1-3-11(17)4-2-10/h1-4,12H,5-9H2,(H,18,22) |
| InChIKey | AUILWNZTJOPVIP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |