C17H19FN4O2S — CID 32512747
N-[1-(4-ethylthiadiazole-5-carbonyl)piperidin-4-yl]-4-fluorobenzamide (PubChem CID 32512747) has the molecular formula C17H19FN4O2S and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[1-(4-ethylthiadiazole-5-carbonyl)piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-(4-ethylthiadiazole-5-carbonyl)piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 32512747 |
| Molecular Formula | C17H19FN4O2S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[1-(4-ethylthiadiazole-5-carbonyl)piperidin-4-yl]-4-fluorobenzamide |
| SMILES | CCc1nnsc1C(=O)N1CCC(NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H19FN4O2S/c1-2-14-15(25-21-20-14)17(24)22-9-7-13(8-10-22)19-16(23)11-3-5-12(18)6-4-11/h3-6,13H,2,7-10H2,1H3,(H,19,23) |
| InChIKey | UCRXGOZJUQHPHR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |