C12H21ClN4OS — CID 119543322
(4-ethylthiadiazol-5-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119543322) has the molecular formula C12H21ClN4OS and a molecular weight of 304.85 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-ethylthiadiazol-5-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119543322 |
| Molecular Formula | C12H21ClN4OS |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CCc1nnsc1C(=O)N1CCC(CNC)CC1.Cl |
| InChI | InChI=1S/C12H20N4OS.ClH/c1-3-10-11(18-15-14-10)12(17)16-6-4-9(5-7-16)8-13-2;/h9,13H,3-8H2,1-2H3;1H |
| InChIKey | PXCNCFSYCSQWDH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |