C11H19ClN4OS — CID 119649161
(4-ethylthiadiazol-5-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119649161) has the molecular formula C11H19ClN4OS and a molecular weight of 290.82 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | (4-ethylthiadiazol-5-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119649161 |
| Molecular Formula | C11H19ClN4OS |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | CCc1nnsc1C(=O)N1CCCC1CNC.Cl |
| InChI | InChI=1S/C11H18N4OS.ClH/c1-3-9-10(17-14-13-9)11(16)15-6-4-5-8(15)7-12-2;/h8,12H,3-7H2,1-2H3;1H |
| InChIKey | BMGAYWGCEVRBEM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |