C14H18N6OS — CID 124940608
(4-ethylthiadiazol-5-yl)-[(2R)-2-[6-(methylamino)pyrazin-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 124940608) has the molecular formula C14H18N6OS and a molecular weight of 318.41 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[(2R)-2-[6-(methylamino)pyrazin-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (4-ethylthiadiazol-5-yl)-[(2R)-2-[6-(methylamino)pyrazin-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124940608 |
| Molecular Formula | C14H18N6OS |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[(2R)-2-[6-(methylamino)pyrazin-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | CCc1nnsc1C(=O)N1CCC[C@@H]1c1cncc(NC)n1 |
| InChI | InChI=1S/C14H18N6OS/c1-3-9-13(22-19-18-9)14(21)20-6-4-5-11(20)10-7-16-8-12(15-2)17-10/h7-8,11H,3-6H2,1-2H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | AHLNEOCQPSCLPZ-LLVKDONJSA-N |
| XLogP | 1.91 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |