C13H22N4OS — CID 65209884
(4-tert-butylthiadiazol-5-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 65209884) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is (4-tert-butylthiadiazol-5-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-tert-butylthiadiazol-5-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 65209884 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (4-tert-butylthiadiazol-5-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)c2snnc2C(C)(C)C)C1 |
| InChI | InChI=1S/C13H22N4OS/c1-13(2,3)11-10(19-16-15-11)12(18)17-6-5-9(8-17)7-14-4/h9,14H,5-8H2,1-4H3 |
| InChIKey | YCCHOKDUTHWOTI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |