C15H18N4O3S — CID 38213671
4-ethyl-N-[1-(furan-3-carbonyl)piperidin-4-yl]thiadiazole-5-carboxamide (PubChem CID 38213671) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-ethyl-N-[1-(furan-3-carbonyl)piperidin-4-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[1-(furan-3-carbonyl)piperidin-4-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 38213671 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-ethyl-N-[1-(furan-3-carbonyl)piperidin-4-yl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NC1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C15H18N4O3S/c1-2-12-13(23-18-17-12)14(20)16-11-3-6-19(7-4-11)15(21)10-5-8-22-9-10/h5,8-9,11H,2-4,6-7H2,1H3,(H,16,20) |
| InChIKey | KEKQWZIISUZDSX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |