C17H19F2N3O3 — CID 56854771
(3S,5R,9R)-11-[(3,4-difluorophenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione (PubChem CID 56854771) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is (3S,5R,9R)-11-[(3,4-difluorophenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione.
| Compound Name | (3S,5R,9R)-11-[(3,4-difluorophenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
|---|---|
| PubChem CID | 56854771 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (3S,5R,9R)-11-[(3,4-difluorophenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
| SMILES | O=C1[C@@H]2C[C@@H](O)CN2C(=O)[C@H]2CN(Cc3ccc(F)c(F)c3)CCN12 |
| InChI | InChI=1S/C17H19F2N3O3/c18-12-2-1-10(5-13(12)19)7-20-3-4-21-15(9-20)17(25)22-8-11(23)6-14(22)16(21)24/h1-2,5,11,14-15,23H,3-4,6-9H2/t11-,14+,15-/m1/s1 |
| InChIKey | RGWIIXJXWBRSQH-BYCMXARLSA-N |
| XLogP | -0.05 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |