C17H19F2N3O2 — CID 56854407
(3S,5S,9R)-5-[(3,4-difluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (PubChem CID 56854407) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is (3S,5S,9R)-5-[(3,4-difluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione.
| Compound Name | (3S,5S,9R)-5-[(3,4-difluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
|---|---|
| PubChem CID | 56854407 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (3S,5S,9R)-5-[(3,4-difluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
| SMILES | O=C1[C@@H]2C[C@H](NCc3ccc(F)c(F)c3)CN2C(=O)[C@H]2CCCN12 |
| InChI | InChI=1S/C17H19F2N3O2/c18-12-4-3-10(6-13(12)19)8-20-11-7-15-17(24)21-5-1-2-14(21)16(23)22(15)9-11/h3-4,6,11,14-15,20H,1-2,5,7-9H2/t11-,14+,15-/m0/s1 |
| InChIKey | BCARCMHYDKWDTQ-GLQYFDAESA-N |
| XLogP | 1.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |