C17H18FN3O4 — CID 126460634
(4-fluorophenyl) N-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]carbamate (PubChem CID 126460634) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is (4-fluorophenyl) N-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]carbamate.
| Compound Name | (4-fluorophenyl) N-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]carbamate |
|---|---|
| PubChem CID | 126460634 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (4-fluorophenyl) N-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]carbamate |
| SMILES | O=C(N[C@H]1C[C@H]2C(=O)N3CCC[C@@H]3C(=O)N2C1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O4/c18-10-3-5-12(6-4-10)25-17(24)19-11-8-14-16(23)20-7-1-2-13(20)15(22)21(14)9-11/h3-6,11,13-14H,1-2,7-9H2,(H,19,24)/t11-,13+,14-/m0/s1 |
| InChIKey | XZBTWTNSXHILSZ-YUTCNCBUSA-N |
| XLogP | 0.89 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |