C20H26N4O3 — CID 56857726
1-[(3S,5S,9S)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 56857726) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[(3S,5S,9S)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[(3S,5S,9S)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 56857726 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[(3S,5S,9S)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)N[C@H]2C[C@H]3C(=O)N4CCC[C@H]4C(=O)N3C2)cc1 |
| InChI | InChI=1S/C20H26N4O3/c1-12(2)13-5-7-14(8-6-13)21-20(27)22-15-10-17-19(26)23-9-3-4-16(23)18(25)24(17)11-15/h5-8,12,15-17H,3-4,9-11H2,1-2H3,(H2,21,22,27)/t15-,16-,17-/m0/s1 |
| InChIKey | UMHPPHSFVNBSAR-ULQDDVLXSA-N |
| XLogP | 1.91 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |