C17H20N4O3 — CID 56854334
1-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-phenylurea (PubChem CID 56854334) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-phenylurea.
| Compound Name | 1-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 56854334 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@H]1C[C@H]2C(=O)N3CCC[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C17H20N4O3/c22-15-13-7-4-8-20(13)16(23)14-9-12(10-21(14)15)19-17(24)18-11-5-2-1-3-6-11/h1-3,5-6,12-14H,4,7-10H2,(H2,18,19,24)/t12-,13+,14-/m0/s1 |
| InChIKey | LBYNWBBKOZDQPH-MJBXVCDLSA-N |
| XLogP | 0.78 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |