C19H22N4O4 — CID 162806800
1-(4-acetylphenyl)-3-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]urea (PubChem CID 162806800) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]urea |
|---|---|
| PubChem CID | 162806800 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)N[C@@H]2CCN3C(=O)[C@H]4CCCN4C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-11(24)12-4-6-13(7-5-12)20-19(27)21-14-8-10-23-16(14)18(26)22-9-2-3-15(22)17(23)25/h4-7,14-16H,2-3,8-10H2,1H3,(H2,20,21,27)/t14-,15-,16+/m1/s1 |
| InChIKey | ZCRHAEOTAHSKIE-OAGGEKHMSA-N |
| XLogP | 0.98 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |