C19H24N4O3 — CID 163072482
1-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-4-yl]-3-(4-methylphenyl)urea (PubChem CID 163072482) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-4-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-4-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 163072482 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.4.0.03,7]tridecan-4-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N[C@@H]2CCN3C(=O)[C@H]4CCCCN4C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-12-5-7-13(8-6-12)20-19(26)21-14-9-11-23-16(14)18(25)22-10-3-2-4-15(22)17(23)24/h5-8,14-16H,2-4,9-11H2,1H3,(H2,20,21,26)/t14-,15-,16+/m1/s1 |
| InChIKey | HJTGFCZNMCLGGH-OAGGEKHMSA-N |
| XLogP | 1.48 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |