C15H17N3O3S — CID 162807351
N-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide (PubChem CID 162807351) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162807351 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[(3S,4R,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCN2C(=O)[C@H]3CCCN3C(=O)[C@H]12)c1cccs1 |
| InChI | InChI=1S/C15H17N3O3S/c19-13(11-4-2-8-22-11)16-9-5-7-18-12(9)15(21)17-6-1-3-10(17)14(18)20/h2,4,8-10,12H,1,3,5-7H2,(H,16,19)/t9-,10-,12+/m1/s1 |
| InChIKey | MWRRQYZTXOOKNT-FOGDFJRCSA-N |
| XLogP | 0.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |