C16H19N3O4S — CID 11866078
N-[(3S,4S,9S,11R)-11-methoxy-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide (PubChem CID 11866078) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[(3S,4S,9S,11R)-11-methoxy-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3S,4S,9S,11R)-11-methoxy-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11866078 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[(3S,4S,9S,11R)-11-methoxy-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-4-yl]thiophene-2-carboxamide |
| SMILES | CO[C@@H]1C[C@H]2C(=O)N3CC[C@H](NC(=O)c4cccs4)[C@H]3C(=O)N2C1 |
| InChI | InChI=1S/C16H19N3O4S/c1-23-9-7-11-15(21)18-5-4-10(13(18)16(22)19(11)8-9)17-14(20)12-3-2-6-24-12/h2-3,6,9-11,13H,4-5,7-8H2,1H3,(H,17,20)/t9-,10+,11+,13+/m1/s1 |
| InChIKey | UTDCOMFLUOBEFQ-BLFANLJRSA-N |
| XLogP | 0.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |