C17H20FN3O2 — CID 126460939
(3S,5S,9S)-5-[(3-fluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (PubChem CID 126460939) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is (3S,5S,9S)-5-[(3-fluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione.
| Compound Name | (3S,5S,9S)-5-[(3-fluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
|---|---|
| PubChem CID | 126460939 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3S,5S,9S)-5-[(3-fluorophenyl)methylamino]-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
| SMILES | O=C1[C@@H]2C[C@H](NCc3cccc(F)c3)CN2C(=O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C17H20FN3O2/c18-12-4-1-3-11(7-12)9-19-13-8-15-17(23)20-6-2-5-14(20)16(22)21(15)10-13/h1,3-4,7,13-15,19H,2,5-6,8-10H2/t13-,14-,15-/m0/s1 |
| InChIKey | OONOTDVEFNMYME-KKUMJFAQSA-N |
| XLogP | 0.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |