C19H23FN2 — CID 97082368
(3S)-N-benzyl-1-[(3-fluorophenyl)methyl]piperidin-3-amine (PubChem CID 97082368) has the molecular formula C19H23FN2 and a molecular weight of 298.41 g/mol. Its IUPAC name is (3S)-N-benzyl-1-[(3-fluorophenyl)methyl]piperidin-3-amine.
| Compound Name | (3S)-N-benzyl-1-[(3-fluorophenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 97082368 |
| Molecular Formula | C19H23FN2 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3S)-N-benzyl-1-[(3-fluorophenyl)methyl]piperidin-3-amine |
| SMILES | Fc1cccc(CN2CCC[C@H](NCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H23FN2/c20-18-9-4-8-17(12-18)14-22-11-5-10-19(15-22)21-13-16-6-2-1-3-7-16/h1-4,6-9,12,19,21H,5,10-11,13-15H2/t19-/m0/s1 |
| InChIKey | UFIWXOGYHJVQIE-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |