C20H26N2OS — CID 131929815
3-[[3-[(3-methylsulfanylphenyl)methylamino]piperidin-1-yl]methyl]phenol (PubChem CID 131929815) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 3-[[3-[(3-methylsulfanylphenyl)methylamino]piperidin-1-yl]methyl]phenol.
| Compound Name | 3-[[3-[(3-methylsulfanylphenyl)methylamino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 131929815 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-[[3-[(3-methylsulfanylphenyl)methylamino]piperidin-1-yl]methyl]phenol |
| SMILES | CSc1cccc(CNC2CCCN(Cc3cccc(O)c3)C2)c1 |
| InChI | InChI=1S/C20H26N2OS/c1-24-20-9-3-5-16(12-20)13-21-18-7-4-10-22(15-18)14-17-6-2-8-19(23)11-17/h2-3,5-6,8-9,11-12,18,21,23H,4,7,10,13-15H2,1H3 |
| InChIKey | XAXDYOHBSUXXFA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |