C22H31N5O — CID 131946815
3-[[3-[(2-piperidin-1-ylpyrimidin-5-yl)methylamino]piperidin-1-yl]methyl]phenol (PubChem CID 131946815) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[[3-[(2-piperidin-1-ylpyrimidin-5-yl)methylamino]piperidin-1-yl]methyl]phenol.
| Compound Name | 3-[[3-[(2-piperidin-1-ylpyrimidin-5-yl)methylamino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 131946815 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 3-[[3-[(2-piperidin-1-ylpyrimidin-5-yl)methylamino]piperidin-1-yl]methyl]phenol |
| SMILES | Oc1cccc(CN2CCCC(NCc3cnc(N4CCCCC4)nc3)C2)c1 |
| InChI | InChI=1S/C22H31N5O/c28-21-8-4-6-18(12-21)16-26-9-5-7-20(17-26)23-13-19-14-24-22(25-15-19)27-10-2-1-3-11-27/h4,6,8,12,14-15,20,23,28H,1-3,5,7,9-11,13,16-17H2 |
| InChIKey | NBQQCDWCRDBSHO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |