C16H23N3O4 — CID 131934062
3-[[1-[(3-hydroxyphenyl)methyl]piperidin-3-yl]carbamoylamino]propanoic acid (PubChem CID 131934062) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[[1-[(3-hydroxyphenyl)methyl]piperidin-3-yl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[1-[(3-hydroxyphenyl)methyl]piperidin-3-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 131934062 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-[[1-[(3-hydroxyphenyl)methyl]piperidin-3-yl]carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NC1CCCN(Cc2cccc(O)c2)C1 |
| InChI | InChI=1S/C16H23N3O4/c20-14-5-1-3-12(9-14)10-19-8-2-4-13(11-19)18-16(23)17-7-6-15(21)22/h1,3,5,9,13,20H,2,4,6-8,10-11H2,(H,21,22)(H2,17,18,23) |
| InChIKey | KPJNVPGMJRXOGS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |