C20H22N4O2 — CID 126461972
(3S,5S,9S)-5-(quinolin-5-ylmethylamino)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione (PubChem CID 126461972) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (3S,5S,9S)-5-(quinolin-5-ylmethylamino)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione.
| Compound Name | (3S,5S,9S)-5-(quinolin-5-ylmethylamino)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
|---|---|
| PubChem CID | 126461972 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3S,5S,9S)-5-(quinolin-5-ylmethylamino)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,8-dione |
| SMILES | O=C1[C@@H]2C[C@H](NCc3cccc4ncccc34)CN2C(=O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C20H22N4O2/c25-19-17-7-3-9-23(17)20(26)18-10-14(12-24(18)19)22-11-13-4-1-6-16-15(13)5-2-8-21-16/h1-2,4-6,8,14,17-18,22H,3,7,9-12H2/t14-,17-,18-/m0/s1 |
| InChIKey | DWHFIOWATRXRLW-WBAXXEDZSA-N |
| XLogP | 1.30 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |