C24H31FN4O4 — CID 163144799
(3R,5S,9S)-N-cyclohexyl-5-[(4-fluorophenyl)methoxy]-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxamide (PubChem CID 163144799) has the molecular formula C24H31FN4O4 and a molecular weight of 458.53 g/mol. Its IUPAC name is (3R,5S,9S)-N-cyclohexyl-5-[(4-fluorophenyl)methoxy]-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxamide.
| Compound Name | (3R,5S,9S)-N-cyclohexyl-5-[(4-fluorophenyl)methoxy]-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxamide |
|---|---|
| PubChem CID | 163144799 |
| Molecular Formula | C24H31FN4O4 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (3R,5S,9S)-N-cyclohexyl-5-[(4-fluorophenyl)methoxy]-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN2C(=O)[C@H]3C[C@H](OCc4ccc(F)cc4)CN3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C24H31FN4O4/c25-17-8-6-16(7-9-17)15-33-19-12-20-22(30)28-11-10-27(14-21(28)23(31)29(20)13-19)24(32)26-18-4-2-1-3-5-18/h6-9,18-21H,1-5,10-15H2,(H,26,32)/t19-,20+,21-/m0/s1 |
| InChIKey | LDJYQQDFAPWOSV-HBMCJLEFSA-N |
| XLogP | 1.88 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |